C17H20BrIN6O — CID 111014810
1-[(5-bromo-2-methoxyphenyl)methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111014810) has the molecular formula C17H20BrIN6O and a molecular weight of 531.20 g/mol. Its IUPAC name is 1-[(5-bromo-2-methoxyphenyl)methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[(5-bromo-2-methoxyphenyl)methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111014810 |
| Molecular Formula | C17H20BrIN6O |
| Molecular Weight | 531.20 g/mol |
| Exact Mass | 529.99 |
| IUPAC Name | 1-[(5-bromo-2-methoxyphenyl)methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cc(Br)ccc1OC)NCc1nnc2ccccn12.I |
| InChI | InChI=1S/C17H19BrN6O.HI/c1-19-17(20-10-12-9-13(18)6-7-14(12)25-2)21-11-16-23-22-15-5-3-4-8-24(15)16;/h3-9H,10-11H2,1-2H3,(H2,19,20,21);1H |
| InChIKey | JZQWJESKHZVCDM-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 75.84 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 26 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 531.20 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|