C16H16BrFN6 — CID 111016411
1-[(2-bromo-5-fluorophenyl)methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 111016411) has the molecular formula C16H16BrFN6 and a molecular weight of 391.25 g/mol. Its IUPAC name is 1-[(2-bromo-5-fluorophenyl)methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 1-[(2-bromo-5-fluorophenyl)methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111016411 |
| Molecular Formula | C16H16BrFN6 |
| Molecular Weight | 391.25 g/mol |
| Exact Mass | 390.06 |
| IUPAC Name | 1-[(2-bromo-5-fluorophenyl)methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | C/N=C(\NCc1cc(F)ccc1Br)NCc1nnc2ccccn12 |
| InChI | InChI=1S/C16H16BrFN6/c1-19-16(20-9-11-8-12(18)5-6-13(11)17)21-10-15-23-22-14-4-2-3-7-24(14)15/h2-8H,9-10H2,1H3,(H2,19,20,21) |
| InChIKey | VPFHTYBLXBTYQM-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 391.25 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|