C14H16BrIN6S — CID 111015484
1-[(5-bromothiophen-2-yl)methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111015484) has the molecular formula C14H16BrIN6S and a molecular weight of 507.20 g/mol. Its IUPAC name is 1-[(5-bromothiophen-2-yl)methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[(5-bromothiophen-2-yl)methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111015484 |
| Molecular Formula | C14H16BrIN6S |
| Molecular Weight | 507.20 g/mol |
| Exact Mass | 505.94 |
| IUPAC Name | 1-[(5-bromothiophen-2-yl)methyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1ccc(Br)s1)NCc1nnc2ccccn12.I |
| InChI | InChI=1S/C14H15BrN6S.HI/c1-16-14(17-8-10-5-6-11(15)22-10)18-9-13-20-19-12-4-2-3-7-21(12)13;/h2-7H,8-9H2,1H3,(H2,16,17,18);1H |
| InChIKey | RUZJGQHVPBFUNM-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 23 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 507.20 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|