C16H20IN7 — CID 111014484
2-methyl-1-[(6-methyl-2-pyridinyl)methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111014484) has the molecular formula C16H20IN7 and a molecular weight of 437.29 g/mol. Its IUPAC name is 2-methyl-1-[(6-methyl-2-pyridinyl)methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(6-methyl-2-pyridinyl)methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111014484 |
| Molecular Formula | C16H20IN7 |
| Molecular Weight | 437.29 g/mol |
| Exact Mass | 437.08 |
| IUPAC Name | 2-methyl-1-[(6-methyl-2-pyridinyl)methyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1cccc(C)n1)NCc1nnc2ccccn12.I |
| InChI | InChI=1S/C16H19N7.HI/c1-12-6-5-7-13(20-12)10-18-16(17-2)19-11-15-22-21-14-8-3-4-9-23(14)15;/h3-9H,10-11H2,1-2H3,(H2,17,18,19);1H |
| InChIKey | YBHFSEPUYVQSFN-UHFFFAOYSA-N |
| XLogP | 1.92 |
| TPSA | 79.50 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 437.29 |
| LogP ≤ 5 | 1.92 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|