C18H21F2IN6 — CID 111760108
1-[2-(2,4-difluorophenyl)propyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111760108) has the molecular formula C18H21F2IN6 and a molecular weight of 486.31 g/mol. Its IUPAC name is 1-[2-(2,4-difluorophenyl)propyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(2,4-difluorophenyl)propyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111760108 |
| Molecular Formula | C18H21F2IN6 |
| Molecular Weight | 486.31 g/mol |
| Exact Mass | 486.08 |
| IUPAC Name | 1-[2-(2,4-difluorophenyl)propyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1nnc2ccccn12)NCC(C)c1ccc(F)cc1F.I |
| InChI | InChI=1S/C18H20F2N6.HI/c1-12(14-7-6-13(19)9-15(14)20)10-22-18(21-2)23-11-17-25-24-16-5-3-4-8-26(16)17;/h3-9,12H,10-11H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | YYAVKULLNGPZJF-UHFFFAOYSA-N |
| XLogP | 3.09 |
| TPSA | 66.61 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.31 |
| LogP ≤ 5 | 3.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|