C16H27N7 — CID 111013677
1-[2-(diethylamino)propyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine (PubChem CID 111013677) has the molecular formula C16H27N7 and a molecular weight of 317.44 g/mol. Its IUPAC name is 1-[2-(diethylamino)propyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine.
| Compound Name | 1-[2-(diethylamino)propyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111013677 |
| Molecular Formula | C16H27N7 |
| Molecular Weight | 317.44 g/mol |
| Exact Mass | 317.23 |
| IUPAC Name | 1-[2-(diethylamino)propyl]-2-methyl-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine |
| SMILES | CCN(CC)C(C)CN/C(=N\C)NCc1nnc2ccccn12 |
| InChI | InChI=1S/C16H27N7/c1-5-22(6-2)13(3)11-18-16(17-4)19-12-15-21-20-14-9-7-8-10-23(14)15/h7-10,13H,5-6,11-12H2,1-4H3,(H2,17,18,19) |
| InChIKey | HQVDTFMKWIEXLF-UHFFFAOYSA-N |
| XLogP | 1.12 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.44 |
| LogP ≤ 5 | 1.12 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|