C22H30IN7 — CID 111014094
2-methyl-1-[2-(4-methylphenyl)-2-pyrrolidin-1-ylethyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide (PubChem CID 111014094) has the molecular formula C22H30IN7 and a molecular weight of 519.44 g/mol. Its IUPAC name is 2-methyl-1-[2-(4-methylphenyl)-2-pyrrolidin-1-ylethyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[2-(4-methylphenyl)-2-pyrrolidin-1-ylethyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111014094 |
| Molecular Formula | C22H30IN7 |
| Molecular Weight | 519.44 g/mol |
| Exact Mass | 519.16 |
| IUPAC Name | 2-methyl-1-[2-(4-methylphenyl)-2-pyrrolidin-1-ylethyl]-3-([1,2,4]triazolo[4,3-a]pyridin-3-ylmethyl)guanidine;hydroiodide |
| SMILES | C/N=C(/NCc1nnc2ccccn12)NCC(c1ccc(C)cc1)N1CCCC1.I |
| InChI | InChI=1S/C22H29N7.HI/c1-17-8-10-18(11-9-17)19(28-12-5-6-13-28)15-24-22(23-2)25-16-21-27-26-20-7-3-4-14-29(20)21;/h3-4,7-11,14,19H,5-6,12-13,15-16H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | QQJBPTDCPGNBJF-UHFFFAOYSA-N |
| XLogP | 3.16 |
| TPSA | 69.85 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.44 |
| LogP ≤ 5 | 3.16 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|