C22H28FN7O — CID 111311900
1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine (PubChem CID 111311900) has the molecular formula C22H28FN7O and a molecular weight of 425.51 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine.
| Compound Name | 1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111311900 |
| Molecular Formula | C22H28FN7O |
| Molecular Weight | 425.51 g/mol |
| Exact Mass | 425.23 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine |
| SMILES | C/N=C(/NCCc1nnc2ccccn12)NCC(c1ccc(F)cc1)N1CCOCC1 |
| InChI | InChI=1S/C22H28FN7O/c1-24-22(25-10-9-21-28-27-20-4-2-3-11-30(20)21)26-16-19(29-12-14-31-15-13-29)17-5-7-18(23)8-6-17/h2-8,11,19H,9-10,12-16H2,1H3,(H2,24,25,26) |
| InChIKey | FYXUYIFXTUTPIE-UHFFFAOYSA-N |
| XLogP | 1.65 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 31 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 425.51 |
| LogP ≤ 5 | 1.65 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|