C19H29FIN7O — CID 111311843
1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methylguanidine;hydroiodide (PubChem CID 111311843) has the molecular formula C19H29FIN7O and a molecular weight of 517.39 g/mol. Its IUPAC name is 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methylguanidine;hydroiodide.
| Compound Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methylguanidine;hydroiodide |
|---|---|
| PubChem CID | 111311843 |
| Molecular Formula | C19H29FIN7O |
| Molecular Weight | 517.39 g/mol |
| Exact Mass | 517.15 |
| IUPAC Name | 1-[(4,5-dimethyl-1,2,4-triazol-3-yl)methyl]-3-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methylguanidine;hydroiodide |
| SMILES | C/N=C(\NCc1nnc(C)n1C)NCC(c1ccc(F)cc1)N1CCOCC1.I |
| InChI | InChI=1S/C19H28FN7O.HI/c1-14-24-25-18(26(14)3)13-23-19(21-2)22-12-17(27-8-10-28-11-9-27)15-4-6-16(20)7-5-15;/h4-7,17H,8-13H2,1-3H3,(H2,21,22,23);1H |
| InChIKey | DNFRLLWKKLFMBU-UHFFFAOYSA-N |
| XLogP | 1.62 |
| TPSA | 79.60 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 517.39 |
| LogP ≤ 5 | 1.62 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|