C18H24FN5O2 — CID 111964805
1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methyl-3-(1,2-oxazol-3-ylmethyl)guanidine (PubChem CID 111964805) has the molecular formula C18H24FN5O2 and a molecular weight of 361.42 g/mol. Its IUPAC name is 1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methyl-3-(1,2-oxazol-3-ylmethyl)guanidine.
| Compound Name | 1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methyl-3-(1,2-oxazol-3-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111964805 |
| Molecular Formula | C18H24FN5O2 |
| Molecular Weight | 361.42 g/mol |
| Exact Mass | 361.19 |
| IUPAC Name | 1-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methyl-3-(1,2-oxazol-3-ylmethyl)guanidine |
| SMILES | C/N=C(\NCc1ccon1)NCC(c1ccc(F)cc1)N1CCOCC1 |
| InChI | InChI=1S/C18H24FN5O2/c1-20-18(21-12-16-6-9-26-23-16)22-13-17(24-7-10-25-11-8-24)14-2-4-15(19)5-3-14/h2-6,9,17H,7-8,10-13H2,1H3,(H2,20,21,22) |
| InChIKey | DMCBJWXXIBJERY-UHFFFAOYSA-N |
| XLogP | 1.55 |
| TPSA | 74.92 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 361.42 |
| LogP ≤ 5 | 1.55 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|