C20H28FN5OS — CID 111774758
1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methylguanidine (PubChem CID 111774758) has the molecular formula C20H28FN5OS and a molecular weight of 405.54 g/mol. Its IUPAC name is 1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methylguanidine.
| Compound Name | 1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methylguanidine |
|---|---|
| PubChem CID | 111774758 |
| Molecular Formula | C20H28FN5OS |
| Molecular Weight | 405.54 g/mol |
| Exact Mass | 405.20 |
| IUPAC Name | 1-[(2,4-dimethyl-1,3-thiazol-5-yl)methyl]-3-[2-(4-fluorophenyl)-2-morpholin-4-ylethyl]-2-methylguanidine |
| SMILES | C/N=C(\NCc1sc(C)nc1C)NCC(c1ccc(F)cc1)N1CCOCC1 |
| InChI | InChI=1S/C20H28FN5OS/c1-14-19(28-15(2)25-14)13-24-20(22-3)23-12-18(26-8-10-27-11-9-26)16-4-6-17(21)7-5-16/h4-7,18H,8-13H2,1-3H3,(H2,22,23,24) |
| InChIKey | RGYQUDCGTDTYHR-UHFFFAOYSA-N |
| XLogP | 2.64 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 405.54 |
| LogP ≤ 5 | 2.64 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|