C24H33N7O — CID 111308758
1-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-2-methyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine (PubChem CID 111308758) has the molecular formula C24H33N7O and a molecular weight of 435.58 g/mol. Its IUPAC name is 1-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-2-methyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine.
| Compound Name | 1-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-2-methyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine |
|---|---|
| PubChem CID | 111308758 |
| Molecular Formula | C24H33N7O |
| Molecular Weight | 435.58 g/mol |
| Exact Mass | 435.27 |
| IUPAC Name | 1-[2-(4-methoxyphenyl)-2-piperidin-1-ylethyl]-2-methyl-3-[2-([1,2,4]triazolo[4,3-a]pyridin-3-yl)ethyl]guanidine |
| SMILES | C/N=C(/NCCc1nnc2ccccn12)NCC(c1ccc(OC)cc1)N1CCCCC1 |
| InChI | InChI=1S/C24H33N7O/c1-25-24(26-14-13-23-29-28-22-8-4-7-17-31(22)23)27-18-21(30-15-5-3-6-16-30)19-9-11-20(32-2)12-10-19/h4,7-12,17,21H,3,5-6,13-16,18H2,1-2H3,(H2,25,26,27) |
| InChIKey | SIVLBEYNYYNIEF-UHFFFAOYSA-N |
| XLogP | 2.67 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 32 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 435.58 |
| LogP ≤ 5 | 2.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|