C25H35N7O — CID 111765091
1-ethyl-2-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine (PubChem CID 111765091) has the molecular formula C25H35N7O and a molecular weight of 449.60 g/mol. Its IUPAC name is 1-ethyl-2-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine.
| Compound Name | 1-ethyl-2-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111765091 |
| Molecular Formula | C25H35N7O |
| Molecular Weight | 449.60 g/mol |
| Exact Mass | 449.29 |
| IUPAC Name | 1-ethyl-2-[2-(4-methoxyphenyl)-2-pyrrolidin-1-ylethyl]-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CC(c1ccc(OC)cc1)N1CCCC1)NCCCc1nnc2ccccn12 |
| InChI | InChI=1S/C25H35N7O/c1-3-26-25(27-15-8-10-24-30-29-23-9-4-5-18-32(23)24)28-19-22(31-16-6-7-17-31)20-11-13-21(33-2)14-12-20/h4-5,9,11-14,18,22H,3,6-8,10,15-17,19H2,1-2H3,(H2,26,27,28) |
| InChIKey | JOGIAZDGJYCINV-UHFFFAOYSA-N |
| XLogP | 3.06 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 33 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 449.60 |
| LogP ≤ 5 | 3.06 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|