C19H31N7O — CID 111760407
1-ethyl-2-(2-morpholin-4-ylpropyl)-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine (PubChem CID 111760407) has the molecular formula C19H31N7O and a molecular weight of 373.51 g/mol. Its IUPAC name is 1-ethyl-2-(2-morpholin-4-ylpropyl)-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine.
| Compound Name | 1-ethyl-2-(2-morpholin-4-ylpropyl)-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111760407 |
| Molecular Formula | C19H31N7O |
| Molecular Weight | 373.51 g/mol |
| Exact Mass | 373.26 |
| IUPAC Name | 1-ethyl-2-(2-morpholin-4-ylpropyl)-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CC(C)N1CCOCC1)NCCCc1nnc2ccccn12 |
| InChI | InChI=1S/C19H31N7O/c1-3-20-19(22-15-16(2)25-11-13-27-14-12-25)21-9-6-8-18-24-23-17-7-4-5-10-26(17)18/h4-5,7,10,16H,3,6,8-9,11-15H2,1-2H3,(H2,20,21,22) |
| InChIKey | OACOHYAUYJUYIX-UHFFFAOYSA-N |
| XLogP | 0.94 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 373.51 |
| LogP ≤ 5 | 0.94 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|