C21H35N7O — CID 111767173
1-ethyl-2-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine (PubChem CID 111767173) has the molecular formula C21H35N7O and a molecular weight of 401.56 g/mol. Its IUPAC name is 1-ethyl-2-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine.
| Compound Name | 1-ethyl-2-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine |
|---|---|
| PubChem CID | 111767173 |
| Molecular Formula | C21H35N7O |
| Molecular Weight | 401.56 g/mol |
| Exact Mass | 401.29 |
| IUPAC Name | 1-ethyl-2-[[4-(2-methylpropyl)morpholin-2-yl]methyl]-3-[3-([1,2,4]triazolo[4,3-a]pyridin-3-yl)propyl]guanidine |
| SMILES | CCN/C(=N\CC1CN(CC(C)C)CCO1)NCCCc1nnc2ccccn12 |
| InChI | InChI=1S/C21H35N7O/c1-4-22-21(24-14-18-16-27(12-13-29-18)15-17(2)3)23-10-7-9-20-26-25-19-8-5-6-11-28(19)20/h5-6,8,11,17-18H,4,7,9-10,12-16H2,1-3H3,(H2,22,23,24) |
| InChIKey | MWSUNBKXFDKZNT-UHFFFAOYSA-N |
| XLogP | 1.57 |
| TPSA | 79.08 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 401.56 |
| LogP ≤ 5 | 1.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|