C22H39IN4O3S — CID 111368488
1-(3-benzylsulfonylpropyl)-3-ethyl-2-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111368488) has the molecular formula C22H39IN4O3S and a molecular weight of 566.55 g/mol. Its IUPAC name is 1-(3-benzylsulfonylpropyl)-3-ethyl-2-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-(3-benzylsulfonylpropyl)-3-ethyl-2-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111368488 |
| Molecular Formula | C22H39IN4O3S |
| Molecular Weight | 566.55 g/mol |
| Exact Mass | 566.18 |
| IUPAC Name | 1-(3-benzylsulfonylpropyl)-3-ethyl-2-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CN(CC(C)C)CCO1)NCCCS(=O)(=O)Cc1ccccc1.I |
| InChI | InChI=1S/C22H38N4O3S.HI/c1-4-23-22(25-15-21-17-26(12-13-29-21)16-19(2)3)24-11-8-14-30(27,28)18-20-9-6-5-7-10-20;/h5-7,9-10,19,21H,4,8,11-18H2,1-3H3,(H2,23,24,25);1H |
| InChIKey | RREDXVQFCNMZPZ-UHFFFAOYSA-N |
| XLogP | 2.52 |
| TPSA | 83.03 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 566.55 |
| LogP ≤ 5 | 2.52 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|