C25H42IN5O2 — CID 111831419
1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-3-ethyl-2-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine;hydroiodide (PubChem CID 111831419) has the molecular formula C25H42IN5O2 and a molecular weight of 571.55 g/mol. Its IUPAC name is 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-3-ethyl-2-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine;hydroiodide.
| Compound Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-3-ethyl-2-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111831419 |
| Molecular Formula | C25H42IN5O2 |
| Molecular Weight | 571.55 g/mol |
| Exact Mass | 571.24 |
| IUPAC Name | 1-[4-(3,4-dihydro-1H-isoquinolin-2-yl)-4-oxobutyl]-3-ethyl-2-[[4-(2-methylpropyl)morpholin-2-yl]methyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC1CN(CC(C)C)CCO1)NCCCC(=O)N1CCc2ccccc2C1.I |
| InChI | InChI=1S/C25H41N5O2.HI/c1-4-26-25(28-16-23-19-29(14-15-32-23)17-20(2)3)27-12-7-10-24(31)30-13-11-21-8-5-6-9-22(21)18-30;/h5-6,8-9,20,23H,4,7,10-19H2,1-3H3,(H2,26,27,28);1H |
| InChIKey | KGWBZSGNUQNXBP-UHFFFAOYSA-N |
| XLogP | 2.88 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 33 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 571.55 |
| LogP ≤ 5 | 2.88 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|