C20H31N5OS — CID 111021519
1-[3-(1,3-benzothiazol-2-yl)propyl]-3-ethyl-2-(2-morpholin-4-ylpropyl)guanidine (PubChem CID 111021519) has the molecular formula C20H31N5OS and a molecular weight of 389.57 g/mol. Its IUPAC name is 1-[3-(1,3-benzothiazol-2-yl)propyl]-3-ethyl-2-(2-morpholin-4-ylpropyl)guanidine.
| Compound Name | 1-[3-(1,3-benzothiazol-2-yl)propyl]-3-ethyl-2-(2-morpholin-4-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111021519 |
| Molecular Formula | C20H31N5OS |
| Molecular Weight | 389.57 g/mol |
| Exact Mass | 389.22 |
| IUPAC Name | 1-[3-(1,3-benzothiazol-2-yl)propyl]-3-ethyl-2-(2-morpholin-4-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(C)N1CCOCC1)NCCCc1nc2ccccc2s1 |
| InChI | InChI=1S/C20H31N5OS/c1-3-21-20(23-15-16(2)25-11-13-26-14-12-25)22-10-6-9-19-24-17-7-4-5-8-18(17)27-19/h4-5,7-8,16H,3,6,9-15H2,1-2H3,(H2,21,22,23) |
| InChIKey | LXDABACOQIIJQJ-UHFFFAOYSA-N |
| XLogP | 2.50 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 389.57 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|