C22H35IN4O2S — CID 111643895
2-[3-(1,3-benzothiazol-2-yl)propyl]-1-ethyl-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide (PubChem CID 111643895) has the molecular formula C22H35IN4O2S and a molecular weight of 546.52 g/mol. Its IUPAC name is 2-[3-(1,3-benzothiazol-2-yl)propyl]-1-ethyl-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 2-[3-(1,3-benzothiazol-2-yl)propyl]-1-ethyl-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111643895 |
| Molecular Formula | C22H35IN4O2S |
| Molecular Weight | 546.52 g/mol |
| Exact Mass | 546.15 |
| IUPAC Name | 2-[3-(1,3-benzothiazol-2-yl)propyl]-1-ethyl-3-[3-(oxan-4-ylmethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCc1nc2ccccc2s1)NCCCOCC1CCOCC1.I |
| InChI | InChI=1S/C22H34N4O2S.HI/c1-2-23-22(25-13-6-14-28-17-18-10-15-27-16-11-18)24-12-5-9-21-26-19-7-3-4-8-20(19)29-21;/h3-4,7-8,18H,2,5-6,9-17H2,1H3,(H2,23,24,25);1H |
| InChIKey | MJGBDTWVKXQBII-UHFFFAOYSA-N |
| XLogP | 4.24 |
| TPSA | 67.77 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 11 |
| Heavy Atoms | 30 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 546.52 |
| LogP ≤ 5 | 4.24 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|