C23H31IN4O3S — CID 111648101
2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-ethyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide (PubChem CID 111648101) has the molecular formula C23H31IN4O3S and a molecular weight of 570.50 g/mol. Its IUPAC name is 2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-ethyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-ethyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111648101 |
| Molecular Formula | C23H31IN4O3S |
| Molecular Weight | 570.50 g/mol |
| Exact Mass | 570.12 |
| IUPAC Name | 2-[[5-(1,3-benzothiazol-2-yl)furan-2-yl]methyl]-1-ethyl-3-[3-(oxolan-3-ylmethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\Cc1ccc(-c2nc3ccccc3s2)o1)NCCCOCC1CCOC1.I |
| InChI | InChI=1S/C23H30N4O3S.HI/c1-2-24-23(25-11-5-12-28-15-17-10-13-29-16-17)26-14-18-8-9-20(30-18)22-27-19-6-3-4-7-21(19)31-22;/h3-4,6-9,17H,2,5,10-16H2,1H3,(H2,24,25,26);1H |
| InChIKey | PMCCFWGLOFOUPA-UHFFFAOYSA-N |
| XLogP | 4.67 |
| TPSA | 80.91 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 32 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 570.50 |
| LogP ≤ 5 | 4.67 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|