C22H38IN3O3 — CID 111646771
1-ethyl-2-[3-(oxolan-3-ylmethoxy)propyl]-3-[3-(1-phenylethoxy)propyl]guanidine;hydroiodide (PubChem CID 111646771) has the molecular formula C22H38IN3O3 and a molecular weight of 519.47 g/mol. Its IUPAC name is 1-ethyl-2-[3-(oxolan-3-ylmethoxy)propyl]-3-[3-(1-phenylethoxy)propyl]guanidine;hydroiodide.
| Compound Name | 1-ethyl-2-[3-(oxolan-3-ylmethoxy)propyl]-3-[3-(1-phenylethoxy)propyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111646771 |
| Molecular Formula | C22H38IN3O3 |
| Molecular Weight | 519.47 g/mol |
| Exact Mass | 519.20 |
| IUPAC Name | 1-ethyl-2-[3-(oxolan-3-ylmethoxy)propyl]-3-[3-(1-phenylethoxy)propyl]guanidine;hydroiodide |
| SMILES | CCN/C(=N\CCCOCC1CCOC1)NCCCOC(C)c1ccccc1.I |
| InChI | InChI=1S/C22H37N3O3.HI/c1-3-23-22(24-12-7-14-26-17-20-11-16-27-18-20)25-13-8-15-28-19(2)21-9-5-4-6-10-21;/h4-6,9-10,19-20H,3,7-8,11-18H2,1-2H3,(H2,23,24,25);1H |
| InChIKey | BVRKIIWVUIYGLB-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 64.11 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 519.47 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|