C20H35N5O2 — CID 111646364
1-ethyl-2-[3-(oxolan-3-ylmethoxy)propyl]-3-[4-(pyridin-2-ylamino)butyl]guanidine (PubChem CID 111646364) has the molecular formula C20H35N5O2 and a molecular weight of 377.53 g/mol. Its IUPAC name is 1-ethyl-2-[3-(oxolan-3-ylmethoxy)propyl]-3-[4-(pyridin-2-ylamino)butyl]guanidine.
| Compound Name | 1-ethyl-2-[3-(oxolan-3-ylmethoxy)propyl]-3-[4-(pyridin-2-ylamino)butyl]guanidine |
|---|---|
| PubChem CID | 111646364 |
| Molecular Formula | C20H35N5O2 |
| Molecular Weight | 377.53 g/mol |
| Exact Mass | 377.28 |
| IUPAC Name | 1-ethyl-2-[3-(oxolan-3-ylmethoxy)propyl]-3-[4-(pyridin-2-ylamino)butyl]guanidine |
| SMILES | CCN/C(=N\CCCOCC1CCOC1)NCCCCNc1ccccn1 |
| InChI | InChI=1S/C20H35N5O2/c1-2-21-20(25-13-7-14-26-16-18-9-15-27-17-18)24-12-6-5-11-23-19-8-3-4-10-22-19/h3-4,8,10,18H,2,5-7,9,11-17H2,1H3,(H,22,23)(H2,21,24,25) |
| InChIKey | JYAOWCMLMBBCOV-UHFFFAOYSA-N |
| XLogP | 2.27 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 13 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 377.53 |
| LogP ≤ 5 | 2.27 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|