C20H32IN5OS2 — CID 111284872
1-ethyl-3-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111284872) has the molecular formula C20H32IN5OS2 and a molecular weight of 549.55 g/mol. Its IUPAC name is 1-ethyl-3-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-ethyl-3-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111284872 |
| Molecular Formula | C20H32IN5OS2 |
| Molecular Weight | 549.55 g/mol |
| Exact Mass | 549.11 |
| IUPAC Name | 1-ethyl-3-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1cccs1)N1CCOCC1)NCCCc1nc(C)cs1.I |
| InChI | InChI=1S/C20H31N5OS2.HI/c1-3-21-20(22-8-4-7-19-24-16(2)15-28-19)23-14-17(18-6-5-13-27-18)25-9-11-26-12-10-25;/h5-6,13,15,17H,3-4,7-12,14H2,1-2H3,(H2,21,22,23);1H |
| InChIKey | LVPWTWBKMRKSKQ-UHFFFAOYSA-N |
| XLogP | 3.69 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 549.55 |
| LogP ≤ 5 | 3.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|