C20H31N5OS2 — CID 111765019
1-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-3-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111765019) has the molecular formula C20H31N5OS2 and a molecular weight of 421.64 g/mol. Its IUPAC name is 1-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-3-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-3-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111765019 |
| Molecular Formula | C20H31N5OS2 |
| Molecular Weight | 421.64 g/mol |
| Exact Mass | 421.20 |
| IUPAC Name | 1-[2-(2,4-dimethyl-1,3-thiazol-5-yl)ethyl]-3-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(c1cccs1)N1CCOCC1)NCCc1sc(C)nc1C |
| InChI | InChI=1S/C20H31N5OS2/c1-4-21-20(22-8-7-18-15(2)24-16(3)28-18)23-14-17(19-6-5-13-27-19)25-9-11-26-12-10-25/h5-6,13,17H,4,7-12,14H2,1-3H3,(H2,21,22,23) |
| InChIKey | SLGDFSPBNOAJJI-UHFFFAOYSA-N |
| XLogP | 2.99 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 421.64 |
| LogP ≤ 5 | 2.99 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|