C19H27ClN4OS2 — CID 111283719
1-[2-(5-chlorothiophen-2-yl)ethyl]-3-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111283719) has the molecular formula C19H27ClN4OS2 and a molecular weight of 427.04 g/mol. Its IUPAC name is 1-[2-(5-chlorothiophen-2-yl)ethyl]-3-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[2-(5-chlorothiophen-2-yl)ethyl]-3-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111283719 |
| Molecular Formula | C19H27ClN4OS2 |
| Molecular Weight | 427.04 g/mol |
| Exact Mass | 426.13 |
| IUPAC Name | 1-[2-(5-chlorothiophen-2-yl)ethyl]-3-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | CCN/C(=N\CC(c1cccs1)N1CCOCC1)NCCc1ccc(Cl)s1 |
| InChI | InChI=1S/C19H27ClN4OS2/c1-2-21-19(22-8-7-15-5-6-18(20)27-15)23-14-16(17-4-3-13-26-17)24-9-11-25-12-10-24/h3-6,13,16H,2,7-12,14H2,1H3,(H2,21,22,23) |
| InChIKey | ANPUKWPSLJREFC-UHFFFAOYSA-N |
| XLogP | 3.63 |
| TPSA | 48.89 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 427.04 |
| LogP ≤ 5 | 3.63 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|