C19H34IN5O2S — CID 111284436
3-[[N-ethyl-N'-(2-morpholin-4-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]-N-propylpropanamide;hydroiodide (PubChem CID 111284436) has the molecular formula C19H34IN5O2S and a molecular weight of 523.49 g/mol. Its IUPAC name is 3-[[N-ethyl-N'-(2-morpholin-4-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]-N-propylpropanamide;hydroiodide.
| Compound Name | 3-[[N-ethyl-N'-(2-morpholin-4-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]-N-propylpropanamide;hydroiodide |
|---|---|
| PubChem CID | 111284436 |
| Molecular Formula | C19H34IN5O2S |
| Molecular Weight | 523.49 g/mol |
| Exact Mass | 523.15 |
| IUPAC Name | 3-[[N-ethyl-N'-(2-morpholin-4-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]-N-propylpropanamide;hydroiodide |
| SMILES | CCCNC(=O)CCN/C(=N/CC(c1cccs1)N1CCOCC1)NCC.I |
| InChI | InChI=1S/C19H33N5O2S.HI/c1-3-8-21-18(25)7-9-22-19(20-4-2)23-15-16(17-6-5-14-27-17)24-10-12-26-13-11-24;/h5-6,14,16H,3-4,7-13,15H2,1-2H3,(H,21,25)(H2,20,22,23);1H |
| InChIKey | ZDZQRVYCPPWBOQ-UHFFFAOYSA-N |
| XLogP | 2.21 |
| TPSA | 77.99 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 523.49 |
| LogP ≤ 5 | 2.21 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|