C20H33N5O2S — CID 111284517
1-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-(3-oxo-3-pyrrolidin-1-ylpropyl)guanidine (PubChem CID 111284517) has the molecular formula C20H33N5O2S and a molecular weight of 407.58 g/mol. Its IUPAC name is 1-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-(3-oxo-3-pyrrolidin-1-ylpropyl)guanidine.
| Compound Name | 1-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-(3-oxo-3-pyrrolidin-1-ylpropyl)guanidine |
|---|---|
| PubChem CID | 111284517 |
| Molecular Formula | C20H33N5O2S |
| Molecular Weight | 407.58 g/mol |
| Exact Mass | 407.24 |
| IUPAC Name | 1-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)-3-(3-oxo-3-pyrrolidin-1-ylpropyl)guanidine |
| SMILES | CCN/C(=N\CC(c1cccs1)N1CCOCC1)NCCC(=O)N1CCCC1 |
| InChI | InChI=1S/C20H33N5O2S/c1-2-21-20(22-8-7-19(26)25-9-3-4-10-25)23-16-17(18-6-5-15-28-18)24-11-13-27-14-12-24/h5-6,15,17H,2-4,7-14,16H2,1H3,(H2,21,22,23) |
| InChIKey | GNJKLZXYTUHLQY-UHFFFAOYSA-N |
| XLogP | 1.69 |
| TPSA | 69.20 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 407.58 |
| LogP ≤ 5 | 1.69 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|