C18H32IN5O3S2 — CID 111284672
1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111284672) has the molecular formula C18H32IN5O3S2 and a molecular weight of 557.52 g/mol. Its IUPAC name is 1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111284672 |
| Molecular Formula | C18H32IN5O3S2 |
| Molecular Weight | 557.52 g/mol |
| Exact Mass | 557.10 |
| IUPAC Name | 1-[2-(1,1-dioxo-1,2-thiazolidin-2-yl)ethyl]-3-ethyl-2-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | CCN/C(=N\CC(c1cccs1)N1CCOCC1)NCCN1CCCS1(=O)=O.I |
| InChI | InChI=1S/C18H31N5O3S2.HI/c1-2-19-18(20-6-8-23-7-4-14-28(23,24)25)21-15-16(17-5-3-13-27-17)22-9-11-26-12-10-22;/h3,5,13,16H,2,4,6-12,14-15H2,1H3,(H2,19,20,21);1H |
| InChIKey | GREPHIWNZFRXCU-UHFFFAOYSA-N |
| XLogP | 1.33 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 29 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 557.52 |
| LogP ≤ 5 | 1.33 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|