C19H30IN5OS2 — CID 111284870
2-methyl-1-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide (PubChem CID 111284870) has the molecular formula C19H30IN5OS2 and a molecular weight of 535.52 g/mol. Its IUPAC name is 2-methyl-1-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
|---|---|
| PubChem CID | 111284870 |
| Molecular Formula | C19H30IN5OS2 |
| Molecular Weight | 535.52 g/mol |
| Exact Mass | 535.09 |
| IUPAC Name | 2-methyl-1-[3-(4-methyl-1,3-thiazol-2-yl)propyl]-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine;hydroiodide |
| SMILES | C/N=C(\NCCCc1nc(C)cs1)NCC(c1cccs1)N1CCOCC1.I |
| InChI | InChI=1S/C19H29N5OS2.HI/c1-15-14-27-18(23-15)6-3-7-21-19(20-2)22-13-16(17-5-4-12-26-17)24-8-10-25-11-9-24;/h4-5,12,14,16H,3,6-11,13H2,1-2H3,(H2,20,21,22);1H |
| InChIKey | ZYQLNRCGHOEPIQ-UHFFFAOYSA-N |
| XLogP | 3.30 |
| TPSA | 61.78 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 535.52 |
| LogP ≤ 5 | 3.30 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|