C17H26N6O2S — CID 111284191
2-methyl-1-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111284191) has the molecular formula C17H26N6O2S and a molecular weight of 378.50 g/mol. Its IUPAC name is 2-methyl-1-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 2-methyl-1-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111284191 |
| Molecular Formula | C17H26N6O2S |
| Molecular Weight | 378.50 g/mol |
| Exact Mass | 378.18 |
| IUPAC Name | 2-methyl-1-[2-(3-methyl-1,2,4-oxadiazol-5-yl)ethyl]-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | C/N=C(\NCCc1nc(C)no1)NCC(c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C17H26N6O2S/c1-13-21-16(25-22-13)5-6-19-17(18-2)20-12-14(15-4-3-11-26-15)23-7-9-24-10-8-23/h3-4,11,14H,5-10,12H2,1-2H3,(H2,18,19,20) |
| InChIKey | CTNAHCADYPEDSH-UHFFFAOYSA-N |
| XLogP | 1.22 |
| TPSA | 87.81 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 7 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 378.50 |
| LogP ≤ 5 | 1.22 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 7 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|