C18H29IN6OS — CID 111323307
2-methyl-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-3-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]guanidine;hydroiodide (PubChem CID 111323307) has the molecular formula C18H29IN6OS and a molecular weight of 504.44 g/mol. Its IUPAC name is 2-methyl-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-3-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]guanidine;hydroiodide.
| Compound Name | 2-methyl-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-3-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]guanidine;hydroiodide |
|---|---|
| PubChem CID | 111323307 |
| Molecular Formula | C18H29IN6OS |
| Molecular Weight | 504.44 g/mol |
| Exact Mass | 504.12 |
| IUPAC Name | 2-methyl-1-[(3-methyl-1,2,4-oxadiazol-5-yl)methyl]-3-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]guanidine;hydroiodide |
| SMILES | C/N=C(\NCc1nc(C)no1)NCC(c1cccs1)N1CCC(C)CC1.I |
| InChI | InChI=1S/C18H28N6OS.HI/c1-13-6-8-24(9-7-13)15(16-5-4-10-26-16)11-20-18(19-3)21-12-17-22-14(2)23-25-17;/h4-5,10,13,15H,6-9,11-12H2,1-3H3,(H2,19,20,21);1H |
| InChIKey | BFCQGKJKEGGGCE-UHFFFAOYSA-N |
| XLogP | 3.20 |
| TPSA | 78.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 504.44 |
| LogP ≤ 5 | 3.20 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|