C21H34N6OS — CID 111621264
1-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-methyl-3-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]guanidine (PubChem CID 111621264) has the molecular formula C21H34N6OS and a molecular weight of 418.61 g/mol. Its IUPAC name is 1-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-methyl-3-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]guanidine.
| Compound Name | 1-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-methyl-3-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]guanidine |
|---|---|
| PubChem CID | 111621264 |
| Molecular Formula | C21H34N6OS |
| Molecular Weight | 418.61 g/mol |
| Exact Mass | 418.25 |
| IUPAC Name | 1-[(5-tert-butyl-1,2,4-oxadiazol-3-yl)methyl]-2-methyl-3-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]guanidine |
| SMILES | C/N=C(\NCc1noc(C(C)(C)C)n1)NCC(c1cccs1)N1CCC(C)CC1 |
| InChI | InChI=1S/C21H34N6OS/c1-15-8-10-27(11-9-15)16(17-7-6-12-29-17)13-23-20(22-5)24-14-18-25-19(28-26-18)21(2,3)4/h6-7,12,15-16H,8-11,13-14H2,1-5H3,(H2,22,23,24) |
| InChIKey | GVRCGIZRVNVLDP-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 78.58 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 418.61 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|