C18H28N6S — CID 111323216
2-methyl-1-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-3-(1H-pyrazol-5-ylmethyl)guanidine (PubChem CID 111323216) has the molecular formula C18H28N6S and a molecular weight of 360.53 g/mol. Its IUPAC name is 2-methyl-1-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-3-(1H-pyrazol-5-ylmethyl)guanidine.
| Compound Name | 2-methyl-1-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-3-(1H-pyrazol-5-ylmethyl)guanidine |
|---|---|
| PubChem CID | 111323216 |
| Molecular Formula | C18H28N6S |
| Molecular Weight | 360.53 g/mol |
| Exact Mass | 360.21 |
| IUPAC Name | 2-methyl-1-[2-(4-methylpiperidin-1-yl)-2-thiophen-2-ylethyl]-3-(1H-pyrazol-5-ylmethyl)guanidine |
| SMILES | C/N=C(\NCc1ccn[nH]1)NCC(c1cccs1)N1CCC(C)CC1 |
| InChI | InChI=1S/C18H28N6S/c1-14-6-9-24(10-7-14)16(17-4-3-11-25-17)13-21-18(19-2)20-12-15-5-8-22-23-15/h3-5,8,11,14,16H,6-7,9-10,12-13H2,1-2H3,(H,22,23)(H2,19,20,21) |
| InChIKey | FYTHWIPZVMZQDL-UHFFFAOYSA-N |
| XLogP | 2.61 |
| TPSA | 68.34 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 360.53 |
| LogP ≤ 5 | 2.61 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|