C16H29N5O3S2 — CID 111283725
1-[2-(ethylsulfonylamino)ethyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111283725) has the molecular formula C16H29N5O3S2 and a molecular weight of 403.57 g/mol. Its IUPAC name is 1-[2-(ethylsulfonylamino)ethyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[2-(ethylsulfonylamino)ethyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111283725 |
| Molecular Formula | C16H29N5O3S2 |
| Molecular Weight | 403.57 g/mol |
| Exact Mass | 403.17 |
| IUPAC Name | 1-[2-(ethylsulfonylamino)ethyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | CCS(=O)(=O)NCCN/C(=N\C)NCC(c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C16H29N5O3S2/c1-3-26(22,23)20-7-6-18-16(17-2)19-13-14(15-5-4-12-25-15)21-8-10-24-11-9-21/h4-5,12,14,20H,3,6-11,13H2,1-2H3,(H2,17,18,19) |
| InChIKey | GQYAJAFEEHIZSN-UHFFFAOYSA-N |
| XLogP | 0.23 |
| TPSA | 95.06 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 26 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 403.57 |
| LogP ≤ 5 | 0.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|