C18H33N5O3S2 — CID 111283793
1-[3-[ethylsulfonyl(methyl)amino]propyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine (PubChem CID 111283793) has the molecular formula C18H33N5O3S2 and a molecular weight of 431.63 g/mol. Its IUPAC name is 1-[3-[ethylsulfonyl(methyl)amino]propyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine.
| Compound Name | 1-[3-[ethylsulfonyl(methyl)amino]propyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
|---|---|
| PubChem CID | 111283793 |
| Molecular Formula | C18H33N5O3S2 |
| Molecular Weight | 431.63 g/mol |
| Exact Mass | 431.20 |
| IUPAC Name | 1-[3-[ethylsulfonyl(methyl)amino]propyl]-2-methyl-3-(2-morpholin-4-yl-2-thiophen-2-ylethyl)guanidine |
| SMILES | CCS(=O)(=O)N(C)CCCN/C(=N\C)NCC(c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C18H33N5O3S2/c1-4-28(24,25)22(3)9-6-8-20-18(19-2)21-15-16(17-7-5-14-27-17)23-10-12-26-13-11-23/h5,7,14,16H,4,6,8-13,15H2,1-3H3,(H2,19,20,21) |
| InChIKey | SXYIPNDKRMJLQS-UHFFFAOYSA-N |
| XLogP | 0.96 |
| TPSA | 86.27 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 28 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 431.63 |
| LogP ≤ 5 | 0.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|