C21H36N4O3S — CID 111283619
ethyl 7-[[N'-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]heptanoate (PubChem CID 111283619) has the molecular formula C21H36N4O3S and a molecular weight of 424.61 g/mol. Its IUPAC name is ethyl 7-[[N'-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]heptanoate.
| Compound Name | ethyl 7-[[N'-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]heptanoate |
|---|---|
| PubChem CID | 111283619 |
| Molecular Formula | C21H36N4O3S |
| Molecular Weight | 424.61 g/mol |
| Exact Mass | 424.25 |
| IUPAC Name | ethyl 7-[[N'-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]heptanoate |
| SMILES | CCOC(=O)CCCCCCN/C(=N\C)NCC(c1cccs1)N1CCOCC1 |
| InChI | InChI=1S/C21H36N4O3S/c1-3-28-20(26)10-6-4-5-7-11-23-21(22-2)24-17-18(19-9-8-16-29-19)25-12-14-27-15-13-25/h8-9,16,18H,3-7,10-15,17H2,1-2H3,(H2,22,23,24) |
| InChIKey | XEKMACVZEDRWIJ-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 75.19 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 12 |
| Heavy Atoms | 29 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 424.61 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'} |
|---|