C21H32IN5O3S — CID 111774619
3-methyl-N-[3-[[N'-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]propyl]furan-2-carboxamide;hydroiodide (PubChem CID 111774619) has the molecular formula C21H32IN5O3S and a molecular weight of 561.49 g/mol. Its IUPAC name is 3-methyl-N-[3-[[N'-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]propyl]furan-2-carboxamide;hydroiodide.
| Compound Name | 3-methyl-N-[3-[[N'-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]propyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111774619 |
| Molecular Formula | C21H32IN5O3S |
| Molecular Weight | 561.49 g/mol |
| Exact Mass | 561.13 |
| IUPAC Name | 3-methyl-N-[3-[[N'-methyl-N-(2-morpholin-4-yl-2-thiophen-2-ylethyl)carbamimidoyl]amino]propyl]furan-2-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCCCNC(=O)c1occc1C)NCC(c1cccs1)N1CCOCC1.I |
| InChI | InChI=1S/C21H31N5O3S.HI/c1-16-6-11-29-19(16)20(27)23-7-4-8-24-21(22-2)25-15-17(18-5-3-14-30-18)26-9-12-28-13-10-26;/h3,5-6,11,14,17H,4,7-10,12-13,15H2,1-2H3,(H,23,27)(H2,22,24,25);1H |
| InChIKey | IREOGZJGTYELEZ-UHFFFAOYSA-N |
| XLogP | 2.63 |
| TPSA | 91.13 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 561.49 |
| LogP ≤ 5 | 2.63 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|