C17H25IN4O2S — CID 111775513
3-methyl-N-[3-[[N'-methyl-N-(2-thiophen-2-ylethyl)carbamimidoyl]amino]propyl]furan-2-carboxamide;hydroiodide (PubChem CID 111775513) has the molecular formula C17H25IN4O2S and a molecular weight of 476.38 g/mol. Its IUPAC name is 3-methyl-N-[3-[[N'-methyl-N-(2-thiophen-2-ylethyl)carbamimidoyl]amino]propyl]furan-2-carboxamide;hydroiodide.
| Compound Name | 3-methyl-N-[3-[[N'-methyl-N-(2-thiophen-2-ylethyl)carbamimidoyl]amino]propyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111775513 |
| Molecular Formula | C17H25IN4O2S |
| Molecular Weight | 476.38 g/mol |
| Exact Mass | 476.07 |
| IUPAC Name | 3-methyl-N-[3-[[N'-methyl-N-(2-thiophen-2-ylethyl)carbamimidoyl]amino]propyl]furan-2-carboxamide;hydroiodide |
| SMILES | C/N=C(/NCCCNC(=O)c1occc1C)NCCc1cccs1.I |
| InChI | InChI=1S/C17H24N4O2S.HI/c1-13-7-11-23-15(13)16(22)19-8-4-9-20-17(18-2)21-10-6-14-5-3-12-24-14;/h3,5,7,11-12H,4,6,8-10H2,1-2H3,(H,19,22)(H2,18,20,21);1H |
| InChIKey | STZNGJFSKNSZLG-UHFFFAOYSA-N |
| XLogP | 2.80 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 25 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 476.38 |
| LogP ≤ 5 | 2.80 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|