C14H22F3IN4O2 — CID 109471502
3-methyl-N-[3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propyl]furan-2-carboxamide;hydroiodide (PubChem CID 109471502) has the molecular formula C14H22F3IN4O2 and a molecular weight of 462.25 g/mol. Its IUPAC name is 3-methyl-N-[3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propyl]furan-2-carboxamide;hydroiodide.
| Compound Name | 3-methyl-N-[3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 109471502 |
| Molecular Formula | C14H22F3IN4O2 |
| Molecular Weight | 462.25 g/mol |
| Exact Mass | 462.07 |
| IUPAC Name | 3-methyl-N-[3-[[N'-methyl-N-(3,3,3-trifluoropropyl)carbamimidoyl]amino]propyl]furan-2-carboxamide;hydroiodide |
| SMILES | C/N=C(/NCCCNC(=O)c1occc1C)NCCC(F)(F)F.I |
| InChI | InChI=1S/C14H21F3N4O2.HI/c1-10-4-9-23-11(10)12(22)19-6-3-7-20-13(18-2)21-8-5-14(15,16)17;/h4,9H,3,5-8H2,1-2H3,(H,19,22)(H2,18,20,21);1H |
| InChIKey | ACHBNHBHEOXPPP-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 78.66 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 24 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 462.25 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|