C19H27IN4O3 — CID 111773557
N-[3-[[N-[(2-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]propyl]-3-methylfuran-2-carboxamide;hydroiodide (PubChem CID 111773557) has the molecular formula C19H27IN4O3 and a molecular weight of 486.35 g/mol. Its IUPAC name is N-[3-[[N-[(2-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]propyl]-3-methylfuran-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[N-[(2-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]propyl]-3-methylfuran-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111773557 |
| Molecular Formula | C19H27IN4O3 |
| Molecular Weight | 486.35 g/mol |
| Exact Mass | 486.11 |
| IUPAC Name | N-[3-[[N-[(2-methoxyphenyl)methyl]-N'-methylcarbamimidoyl]amino]propyl]-3-methylfuran-2-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCCCNC(=O)c1occc1C)NCc1ccccc1OC.I |
| InChI | InChI=1S/C19H26N4O3.HI/c1-14-9-12-26-17(14)18(24)21-10-6-11-22-19(20-2)23-13-15-7-4-5-8-16(15)25-3;/h4-5,7-9,12H,6,10-11,13H2,1-3H3,(H,21,24)(H2,20,22,23);1H |
| InChIKey | XBYAYPMRDKWOBT-UHFFFAOYSA-N |
| XLogP | 2.70 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 486.35 |
| LogP ≤ 5 | 2.70 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|