C20H29IN4O3 — CID 111775291
N-[3-[[N-[2-(2-methoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]propyl]-3-methylfuran-2-carboxamide;hydroiodide (PubChem CID 111775291) has the molecular formula C20H29IN4O3 and a molecular weight of 500.38 g/mol. Its IUPAC name is N-[3-[[N-[2-(2-methoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]propyl]-3-methylfuran-2-carboxamide;hydroiodide.
| Compound Name | N-[3-[[N-[2-(2-methoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]propyl]-3-methylfuran-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111775291 |
| Molecular Formula | C20H29IN4O3 |
| Molecular Weight | 500.38 g/mol |
| Exact Mass | 500.13 |
| IUPAC Name | N-[3-[[N-[2-(2-methoxyphenyl)ethyl]-N'-methylcarbamimidoyl]amino]propyl]-3-methylfuran-2-carboxamide;hydroiodide |
| SMILES | C/N=C(\NCCCNC(=O)c1occc1C)NCCc1ccccc1OC.I |
| InChI | InChI=1S/C20H28N4O3.HI/c1-15-10-14-27-18(15)19(25)22-11-6-12-23-20(21-2)24-13-9-16-7-4-5-8-17(16)26-3;/h4-5,7-8,10,14H,6,9,11-13H2,1-3H3,(H,22,25)(H2,21,23,24);1H |
| InChIKey | AHILDFWQZRURJV-UHFFFAOYSA-N |
| XLogP | 2.74 |
| TPSA | 87.89 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 500.38 |
| LogP ≤ 5 | 2.74 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|