C11H19IN4O2 — CID 111439289
3-methyl-N-[3-[(N'-methylcarbamimidoyl)amino]propyl]furan-2-carboxamide;hydroiodide (PubChem CID 111439289) has the molecular formula C11H19IN4O2 and a molecular weight of 366.20 g/mol. Its IUPAC name is 3-methyl-N-[3-[(N'-methylcarbamimidoyl)amino]propyl]furan-2-carboxamide;hydroiodide.
| Compound Name | 3-methyl-N-[3-[(N'-methylcarbamimidoyl)amino]propyl]furan-2-carboxamide;hydroiodide |
|---|---|
| PubChem CID | 111439289 |
| Molecular Formula | C11H19IN4O2 |
| Molecular Weight | 366.20 g/mol |
| Exact Mass | 366.06 |
| IUPAC Name | 3-methyl-N-[3-[(N'-methylcarbamimidoyl)amino]propyl]furan-2-carboxamide;hydroiodide |
| SMILES | C/N=C(\N)NCCCNC(=O)c1occc1C.I |
| InChI | InChI=1S/C11H18N4O2.HI/c1-8-4-7-17-9(8)10(16)14-5-3-6-15-11(12)13-2;/h4,7H,3,5-6H2,1-2H3,(H,14,16)(H3,12,13,15);1H |
| InChIKey | YCSHUVIIFADAEQ-UHFFFAOYSA-N |
| XLogP | 0.86 |
| TPSA | 92.65 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 366.20 |
| LogP ≤ 5 | 0.86 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'imine_1', 'substructure': 'N/A'}, {'alert_name': 'imine_2', 'substructure': 'N/A'}, {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|