C14H24ClN3O3 — CID 120501389
N-[3-[(3-amino-2-methylbutanoyl)amino]propyl]-3-methylfuran-2-carboxamide;hydrochloride (PubChem CID 120501389) has the molecular formula C14H24ClN3O3 and a molecular weight of 317.82 g/mol. Its IUPAC name is N-[3-[(3-amino-2-methylbutanoyl)amino]propyl]-3-methylfuran-2-carboxamide;hydrochloride.
| Compound Name | N-[3-[(3-amino-2-methylbutanoyl)amino]propyl]-3-methylfuran-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 120501389 |
| Molecular Formula | C14H24ClN3O3 |
| Molecular Weight | 317.82 g/mol |
| Exact Mass | 317.15 |
| IUPAC Name | N-[3-[(3-amino-2-methylbutanoyl)amino]propyl]-3-methylfuran-2-carboxamide;hydrochloride |
| SMILES | Cc1ccoc1C(=O)NCCCNC(=O)C(C)C(C)N.Cl |
| InChI | InChI=1S/C14H23N3O3.ClH/c1-9-5-8-20-12(9)14(19)17-7-4-6-16-13(18)10(2)11(3)15;/h5,8,10-11H,4,6-7,15H2,1-3H3,(H,16,18)(H,17,19);1H |
| InChIKey | ZNTVOSRWPPBOGM-UHFFFAOYSA-N |
| XLogP | 1.23 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 317.82 |
| LogP ≤ 5 | 1.23 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|