C13H22ClN3O3 — CID 119331995
N-[3-[(2-amino-2-methylpropanoyl)amino]propyl]-3-methylfuran-2-carboxamide;hydrochloride (PubChem CID 119331995) has the molecular formula C13H22ClN3O3 and a molecular weight of 303.79 g/mol. Its IUPAC name is N-[3-[(2-amino-2-methylpropanoyl)amino]propyl]-3-methylfuran-2-carboxamide;hydrochloride.
| Compound Name | N-[3-[(2-amino-2-methylpropanoyl)amino]propyl]-3-methylfuran-2-carboxamide;hydrochloride |
|---|---|
| PubChem CID | 119331995 |
| Molecular Formula | C13H22ClN3O3 |
| Molecular Weight | 303.79 g/mol |
| Exact Mass | 303.13 |
| IUPAC Name | N-[3-[(2-amino-2-methylpropanoyl)amino]propyl]-3-methylfuran-2-carboxamide;hydrochloride |
| SMILES | Cc1ccoc1C(=O)NCCCNC(=O)C(C)(C)N.Cl |
| InChI | InChI=1S/C13H21N3O3.ClH/c1-9-5-8-19-10(9)11(17)15-6-4-7-16-12(18)13(2,3)14;/h5,8H,4,6-7,14H2,1-3H3,(H,15,17)(H,16,18);1H |
| InChIKey | SUCGPZXAITWVRQ-UHFFFAOYSA-N |
| XLogP | 0.98 |
| TPSA | 97.36 Ų |
| H-Bond Donors | 3 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 303.79 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 3 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|