C9H12N2O4 — CID 75483650
2-[(3-methylfuran-2-carbonyl)amino]ethyl carbamate (PubChem CID 75483650) has the molecular formula C9H12N2O4 and a molecular weight of 212.20 g/mol. Its IUPAC name is 2-[(3-methylfuran-2-carbonyl)amino]ethyl carbamate.
| Compound Name | 2-[(3-methylfuran-2-carbonyl)amino]ethyl carbamate |
|---|---|
| PubChem CID | 75483650 |
| Molecular Formula | C9H12N2O4 |
| Molecular Weight | 212.20 g/mol |
| Exact Mass | 212.08 |
| IUPAC Name | 2-[(3-methylfuran-2-carbonyl)amino]ethyl carbamate |
| SMILES | Cc1ccoc1C(=O)NCCOC(N)=O |
| InChI | InChI=1S/C9H12N2O4/c1-6-2-4-14-7(6)8(12)11-3-5-15-9(10)13/h2,4H,3,5H2,1H3,(H2,10,13)(H,11,12) |
| InChIKey | FFVKYZJXVXGHDT-UHFFFAOYSA-N |
| XLogP | 0.41 |
| TPSA | 94.56 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 212.20 |
| LogP ≤ 5 | 0.41 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|