C11H16BrNO3 — CID 106244866
N-(3-bromo-4-methoxybutyl)-3-methylfuran-2-carboxamide (PubChem CID 106244866) has the molecular formula C11H16BrNO3 and a molecular weight of 290.16 g/mol. Its IUPAC name is N-(3-bromo-4-methoxybutyl)-3-methylfuran-2-carboxamide.
| Compound Name | N-(3-bromo-4-methoxybutyl)-3-methylfuran-2-carboxamide |
|---|---|
| PubChem CID | 106244866 |
| Molecular Formula | C11H16BrNO3 |
| Molecular Weight | 290.16 g/mol |
| Exact Mass | 289.03 |
| IUPAC Name | N-(3-bromo-4-methoxybutyl)-3-methylfuran-2-carboxamide |
| SMILES | COCC(Br)CCNC(=O)c1occc1C |
| InChI | InChI=1S/C11H16BrNO3/c1-8-4-6-16-10(8)11(14)13-5-3-9(12)7-15-2/h4,6,9H,3,5,7H2,1-2H3,(H,13,14) |
| InChIKey | XEHMDITYNKCHEU-UHFFFAOYSA-N |
| XLogP | 2.12 |
| TPSA | 51.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.16 |
| LogP ≤ 5 | 2.12 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|