C9H13BrN2O3 — CID 106245303
N-(3-bromo-4-methoxybutyl)-1,2-oxazole-3-carboxamide (PubChem CID 106245303) has the molecular formula C9H13BrN2O3 and a molecular weight of 277.12 g/mol. Its IUPAC name is N-(3-bromo-4-methoxybutyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-(3-bromo-4-methoxybutyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 106245303 |
| Molecular Formula | C9H13BrN2O3 |
| Molecular Weight | 277.12 g/mol |
| Exact Mass | 276.01 |
| IUPAC Name | N-(3-bromo-4-methoxybutyl)-1,2-oxazole-3-carboxamide |
| SMILES | COCC(Br)CCNC(=O)c1ccon1 |
| InChI | InChI=1S/C9H13BrN2O3/c1-14-6-7(10)2-4-11-9(13)8-3-5-15-12-8/h3,5,7H,2,4,6H2,1H3,(H,11,13) |
| InChIKey | LFYGPXSLNXPFKM-UHFFFAOYSA-N |
| XLogP | 1.20 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 277.12 |
| LogP ≤ 5 | 1.20 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|