C10H15BrN2O2 — CID 106157906
N-(5-bromo-4-methylpentyl)-1,2-oxazole-3-carboxamide (PubChem CID 106157906) has the molecular formula C10H15BrN2O2 and a molecular weight of 275.15 g/mol. Its IUPAC name is N-(5-bromo-4-methylpentyl)-1,2-oxazole-3-carboxamide.
| Compound Name | N-(5-bromo-4-methylpentyl)-1,2-oxazole-3-carboxamide |
|---|---|
| PubChem CID | 106157906 |
| Molecular Formula | C10H15BrN2O2 |
| Molecular Weight | 275.15 g/mol |
| Exact Mass | 274.03 |
| IUPAC Name | N-(5-bromo-4-methylpentyl)-1,2-oxazole-3-carboxamide |
| SMILES | CC(CBr)CCCNC(=O)c1ccon1 |
| InChI | InChI=1S/C10H15BrN2O2/c1-8(7-11)3-2-5-12-10(14)9-4-6-15-13-9/h4,6,8H,2-3,5,7H2,1H3,(H,12,14) |
| InChIKey | LBEUWQFKNNHNNL-UHFFFAOYSA-N |
| XLogP | 2.22 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 275.15 |
| LogP ≤ 5 | 2.22 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|