About N-(3-methylbutyl)-1,2-oxazole-3-carboxamide
N-(3-methylbutyl)-1,2-oxazole-3-carboxamide (PubChem CID 110693766) has the molecular formula C9H14N2O2
and a molecular weight of 182.22 g/mol. Its IUPAC name is N-(3-methylbutyl)-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N-(3-methylbutyl)-1,2-oxazole-3-carboxamide |
| PubChem CID | 110693766 |
| Molecular Formula | C9H14N2O2 |
| Molecular Weight | 182.22 g/mol |
| Exact Mass | 182.11 |
| IUPAC Name | N-(3-methylbutyl)-1,2-oxazole-3-carboxamide |
| SMILES | CC(C)CCNC(=O)c1ccon1 |
| InChI | InChI=1S/C9H14N2O2/c1-7(2)3-5-10-9(12)8-4-6-13-11-8/h4,6-7H,3,5H2,1-2H3,(H,10,12) |
| InChIKey | IJJYGZULKJTBPM-UHFFFAOYSA-N |
| XLogP | 1.45 |
| TPSA | 55.13 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 182.22 |
| LogP ≤ 5 | 1.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze N-(3-methylbutyl)-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-(3-methylbutyl)-1,2-oxazole-3-carboxamide?
The IUPAC name of N-(3-methylbutyl)-1,2-oxazole-3-carboxamide (CID 110693766) is N-(3-methylbutyl)-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N-(3-methylbutyl)-1,2-oxazole-3-carboxamide?
The canonical SMILES for N-(3-methylbutyl)-1,2-oxazole-3-carboxamide is CC(C)CCNC(=O)c1ccon1.
What is the InChIKey of N-(3-methylbutyl)-1,2-oxazole-3-carboxamide?
The InChIKey is IJJYGZULKJTBPM-UHFFFAOYSA-N. The full InChI is InChI=1S/C9H14N2O2/c1-7(2)3-5-10-9(12)8-4-6-13-11-8/h4,6-7H,3,5H2,1-2H3,(H,10,12).
What are the key properties of N-(3-methylbutyl)-1,2-oxazole-3-carboxamide?
N-(3-methylbutyl)-1,2-oxazole-3-carboxamide has a molecular weight of 182.22 g/mol, XLogP of 1.45, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for N-(3-methylbutyl)-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 110693766), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).