About N-propan-2-yloxy-1,2-oxazole-3-carboxamide
N-propan-2-yloxy-1,2-oxazole-3-carboxamide (PubChem CID 130688341) has the molecular formula C7H10N2O3
and a molecular weight of 170.17 g/mol. Its IUPAC name is N-propan-2-yloxy-1,2-oxazole-3-carboxamide.
Molecular Properties
| Compound Name | N-propan-2-yloxy-1,2-oxazole-3-carboxamide |
| PubChem CID | 130688341 |
| Molecular Formula | C7H10N2O3 |
| Molecular Weight | 170.17 g/mol |
| Exact Mass | 170.07 |
| IUPAC Name | N-propan-2-yloxy-1,2-oxazole-3-carboxamide |
| SMILES | CC(C)ONC(=O)c1ccon1 |
| InChI | InChI=1S/C7H10N2O3/c1-5(2)12-9-7(10)6-3-4-11-8-6/h3-5H,1-2H3,(H,9,10) |
| InChIKey | AZQREOYRLFXYDW-UHFFFAOYSA-N |
| XLogP | 0.74 |
| TPSA | 64.36 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 170.17 |
| LogP ≤ 5 | 0.74 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N-propan-2-yloxy-1,2-oxazole-3-carboxamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-propan-2-yloxy-1,2-oxazole-3-carboxamide?
The IUPAC name of N-propan-2-yloxy-1,2-oxazole-3-carboxamide (CID 130688341) is N-propan-2-yloxy-1,2-oxazole-3-carboxamide.
What is the SMILES notation for N-propan-2-yloxy-1,2-oxazole-3-carboxamide?
The canonical SMILES for N-propan-2-yloxy-1,2-oxazole-3-carboxamide is CC(C)ONC(=O)c1ccon1.
What is the InChIKey of N-propan-2-yloxy-1,2-oxazole-3-carboxamide?
The InChIKey is AZQREOYRLFXYDW-UHFFFAOYSA-N. The full InChI is InChI=1S/C7H10N2O3/c1-5(2)12-9-7(10)6-3-4-11-8-6/h3-5H,1-2H3,(H,9,10).
What are the key properties of N-propan-2-yloxy-1,2-oxazole-3-carboxamide?
N-propan-2-yloxy-1,2-oxazole-3-carboxamide has a molecular weight of 170.17 g/mol, XLogP of 0.74, 3 rotatable bonds, 1 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for N-propan-2-yloxy-1,2-oxazole-3-carboxamide is sourced from PubChem (CID 130688341), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).